C14H15NO5S — CID 115588816
3-(furan-3-ylmethylsulfamoyl)-4,5-dimethylbenzoic acid (PubChem CID 115588816) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 3-(furan-3-ylmethylsulfamoyl)-4,5-dimethylbenzoic acid.
| Compound Name | 3-(furan-3-ylmethylsulfamoyl)-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 115588816 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-(furan-3-ylmethylsulfamoyl)-4,5-dimethylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(S(=O)(=O)NCc2ccoc2)c1C |
| InChI | InChI=1S/C14H15NO5S/c1-9-5-12(14(16)17)6-13(10(9)2)21(18,19)15-7-11-3-4-20-8-11/h3-6,8,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | OIYVVNURWUONKB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |