C15H19NO3S — CID 61079011
2-thiophen-3-yl-1-(2,3,4-trimethoxyphenyl)ethanamine (PubChem CID 61079011) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 2-thiophen-3-yl-1-(2,3,4-trimethoxyphenyl)ethanamine.
| Compound Name | 2-thiophen-3-yl-1-(2,3,4-trimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 61079011 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 2-thiophen-3-yl-1-(2,3,4-trimethoxyphenyl)ethanamine |
| SMILES | COc1ccc(C(N)Cc2ccsc2)c(OC)c1OC |
| InChI | InChI=1S/C15H19NO3S/c1-17-13-5-4-11(14(18-2)15(13)19-3)12(16)8-10-6-7-20-9-10/h4-7,9,12H,8,16H2,1-3H3 |
| InChIKey | OYMMZFVCMCNMGU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |