C14H15ClO3S — CID 61084070
3-[chloro-(2,3,4-trimethoxyphenyl)methyl]thiophene (PubChem CID 61084070) has the molecular formula C14H15ClO3S and a molecular weight of 298.79 g/mol. Its IUPAC name is 3-[chloro-(2,3,4-trimethoxyphenyl)methyl]thiophene.
| Compound Name | 3-[chloro-(2,3,4-trimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 61084070 |
| Molecular Formula | C14H15ClO3S |
| Molecular Weight | 298.79 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 3-[chloro-(2,3,4-trimethoxyphenyl)methyl]thiophene |
| SMILES | COc1ccc(C(Cl)c2ccsc2)c(OC)c1OC |
| InChI | InChI=1S/C14H15ClO3S/c1-16-11-5-4-10(13(17-2)14(11)18-3)12(15)9-6-7-19-8-9/h4-8,12H,1-3H3 |
| InChIKey | YLDDHHHEEDHPHN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|