C7H3Br2F5OS — CID 61080668
1-(2,5-dibromothiophen-3-yl)-2,2,3,3,3-pentafluoropropan-1-ol (PubChem CID 61080668) has the molecular formula C7H3Br2F5OS and a molecular weight of 389.97 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2,2,3,3,3-pentafluoropropan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
|---|---|
| PubChem CID | 61080668 |
| Molecular Formula | C7H3Br2F5OS |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 387.82 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2,2,3,3,3-pentafluoropropan-1-ol |
| SMILES | OC(c1cc(Br)sc1Br)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3Br2F5OS/c8-3-1-2(5(9)16-3)4(15)6(10,11)7(12,13)14/h1,4,15H |
| InChIKey | PJNFEMVHXQSGLQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|