C7H5Br2F3OS — CID 61082423
1-(2,5-dibromothiophen-3-yl)-3,3,3-trifluoropropan-1-ol (PubChem CID 61082423) has the molecular formula C7H5Br2F3OS and a molecular weight of 353.99 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-3,3,3-trifluoropropan-1-ol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-3,3,3-trifluoropropan-1-ol |
|---|---|
| PubChem CID | 61082423 |
| Molecular Formula | C7H5Br2F3OS |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 351.84 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-3,3,3-trifluoropropan-1-ol |
| SMILES | OC(CC(F)(F)F)c1cc(Br)sc1Br |
| InChI | InChI=1S/C7H5Br2F3OS/c8-5-1-3(6(9)14-5)4(13)2-7(10,11)12/h1,4,13H,2H2 |
| InChIKey | VAVPTAYXUHDBEJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |