C6H3Br2F3OS — CID 61081618
1-(2,5-dibromothiophen-3-yl)-2,2,2-trifluoroethanol (PubChem CID 61081618) has the molecular formula C6H3Br2F3OS and a molecular weight of 339.96 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2,2,2-trifluoroethanol.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 61081618 |
| Molecular Formula | C6H3Br2F3OS |
| Molecular Weight | 339.96 g/mol |
| Exact Mass | 337.82 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2,2,2-trifluoroethanol |
| SMILES | OC(c1cc(Br)sc1Br)C(F)(F)F |
| InChI | InChI=1S/C6H3Br2F3OS/c7-3-1-2(5(8)13-3)4(12)6(9,10)11/h1,4,12H |
| InChIKey | APAQHXPZJOUDQI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |