C15H12Cl2O2 — CID 61081025
(2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol (PubChem CID 61081025) has the molecular formula C15H12Cl2O2 and a molecular weight of 295.17 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol.
| Compound Name | (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 61081025 |
| Molecular Formula | C15H12Cl2O2 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | (2,5-dichlorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc(Cl)ccc1Cl)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H12Cl2O2/c16-10-5-6-12(17)11(8-10)15(18)14-7-9-3-1-2-4-13(9)19-14/h1-6,8,14-15,18H,7H2 |
| InChIKey | RHQONNXIWUWXRV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |