C15H12F2O2 — CID 61100439
(2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol (PubChem CID 61100439) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol.
| Compound Name | (2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol |
|---|---|
| PubChem CID | 61100439 |
| Molecular Formula | C15H12F2O2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2,5-difluorophenyl)-(2,3-dihydro-1-benzofuran-2-yl)methanol |
| SMILES | OC(c1cc(F)ccc1F)C1Cc2ccccc2O1 |
| InChI | InChI=1S/C15H12F2O2/c16-10-5-6-12(17)11(8-10)15(18)14-7-9-3-1-2-4-13(9)19-14/h1-6,8,14-15,18H,7H2 |
| InChIKey | PGQZCLXLOVBTMV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |