C17H17F3O — CID 61089369
(4-tert-butylphenyl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 61089369) has the molecular formula C17H17F3O and a molecular weight of 294.32 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (4-tert-butylphenyl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 61089369 |
| Molecular Formula | C17H17F3O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (4-tert-butylphenyl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)c2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C17H17F3O/c1-17(2,3)11-6-4-10(5-7-11)16(21)15-13(19)8-12(18)9-14(15)20/h4-9,16,21H,1-3H3 |
| InChIKey | ZIVAAHNIPNWDGE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |