C15H18N2O2S — CID 61093832
3-(4-aminophenoxy)-N-methyl-N-(thiophen-3-ylmethyl)propanamide (PubChem CID 61093832) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-(4-aminophenoxy)-N-methyl-N-(thiophen-3-ylmethyl)propanamide.
| Compound Name | 3-(4-aminophenoxy)-N-methyl-N-(thiophen-3-ylmethyl)propanamide |
|---|---|
| PubChem CID | 61093832 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-(4-aminophenoxy)-N-methyl-N-(thiophen-3-ylmethyl)propanamide |
| SMILES | CN(Cc1ccsc1)C(=O)CCOc1ccc(N)cc1 |
| InChI | InChI=1S/C15H18N2O2S/c1-17(10-12-7-9-20-11-12)15(18)6-8-19-14-4-2-13(16)3-5-14/h2-5,7,9,11H,6,8,10,16H2,1H3 |
| InChIKey | ZFMOYGPTVSSOGL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|