C16H22N2O — CID 61099442
2-N-(furan-2-ylmethyl)-2-N-methyl-3-phenylbutane-1,2-diamine (PubChem CID 61099442) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-N-(furan-2-ylmethyl)-2-N-methyl-3-phenylbutane-1,2-diamine.
| Compound Name | 2-N-(furan-2-ylmethyl)-2-N-methyl-3-phenylbutane-1,2-diamine |
|---|---|
| PubChem CID | 61099442 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-N-(furan-2-ylmethyl)-2-N-methyl-3-phenylbutane-1,2-diamine |
| SMILES | CC(c1ccccc1)C(CN)N(C)Cc1ccco1 |
| InChI | InChI=1S/C16H22N2O/c1-13(14-7-4-3-5-8-14)16(11-17)18(2)12-15-9-6-10-19-15/h3-10,13,16H,11-12,17H2,1-2H3 |
| InChIKey | YHFVDORSWBMCEU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |