C19H18N2O4S2 — CID 6111213
(5Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylidene-5-(thiophen-3-ylmethylidene)-1,3-diazinane-4,6-dione (PubChem CID 6111213) has the molecular formula C19H18N2O4S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (5Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylidene-5-(thiophen-3-ylmethylidene)-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylidene-5-(thiophen-3-ylmethylidene)-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 6111213 |
| Molecular Formula | C19H18N2O4S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (5Z)-1-[2-(3,4-dimethoxyphenyl)ethyl]-2-sulfanylidene-5-(thiophen-3-ylmethylidene)-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(CCN2C(=O)/C(=C\c3ccsc3)C(=O)NC2=S)cc1OC |
| InChI | InChI=1S/C19H18N2O4S2/c1-24-15-4-3-12(10-16(15)25-2)5-7-21-18(23)14(17(22)20-19(21)26)9-13-6-8-27-11-13/h3-4,6,8-11H,5,7H2,1-2H3,(H,20,22,26)/b14-9- |
| InChIKey | DLCWVPVFHVFADU-ZROIWOOFSA-N |
| XLogP | 2.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|