C31H27N3O8 — CID 4871632
1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 4871632) has the molecular formula C31H27N3O8 and a molecular weight of 569.57 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4871632 |
| Molecular Formula | C31H27N3O8 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)N(CCc3ccc(OC)c(OC)c3)C2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H27N3O8/c1-40-24-10-9-19(14-20(24)17-34-28(36)21-6-4-5-7-22(21)29(34)37)15-23-27(35)32-31(39)33(30(23)38)13-12-18-8-11-25(41-2)26(16-18)42-3/h4-11,14-16H,12-13,17H2,1-3H3,(H,32,35,39) |
| InChIKey | MDLCMGAWBHEXNK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|