C30H25N3O9 — CID 1415166
5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 1415166) has the molecular formula C30H25N3O9 and a molecular weight of 571.54 g/mol. Its IUPAC name is 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1415166 |
| Molecular Formula | C30H25N3O9 |
| Molecular Weight | 571.54 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(3,4,5-trimethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)N(c3cc(OC)c(OC)c(OC)c3)C2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C30H25N3O9/c1-39-22-10-9-16(11-17(22)15-32-27(35)19-7-5-6-8-20(19)28(32)36)12-21-26(34)31-30(38)33(29(21)37)18-13-23(40-2)25(42-4)24(14-18)41-3/h5-14H,15H2,1-4H3,(H,31,34,38) |
| InChIKey | NHTLLWRWIPZFIF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|