C29H23N3O8 — CID 3848465
1-(2,5-dimethoxyphenyl)-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3848465) has the molecular formula C29H23N3O8 and a molecular weight of 541.52 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3848465 |
| Molecular Formula | C29H23N3O8 |
| Molecular Weight | 541.52 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(OC)c(N2C(=O)NC(=O)C(=Cc3ccc(OC)c(CN4C(=O)c5ccccc5C4=O)c3)C2=O)c1 |
| InChI | InChI=1S/C29H23N3O8/c1-38-18-9-11-24(40-3)22(14-18)32-28(36)21(25(33)30-29(32)37)13-16-8-10-23(39-2)17(12-16)15-31-26(34)19-6-4-5-7-20(19)27(31)35/h4-14H,15H2,1-3H3,(H,30,33,37) |
| InChIKey | WANBHYLMODYXKL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|