C27H18FN3O6 — CID 3453860
5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 3453860) has the molecular formula C27H18FN3O6 and a molecular weight of 499.45 g/mol. Its IUPAC name is 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3453860 |
| Molecular Formula | C27H18FN3O6 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 5-[[3-[(1,3-dioxoisoindol-2-yl)methyl]-4-methoxyphenyl]methylidene]-1-(2-fluorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(C=C2C(=O)NC(=O)N(c3ccccc3F)C2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H18FN3O6/c1-37-22-11-10-15(12-16(22)14-30-24(33)17-6-2-3-7-18(17)25(30)34)13-19-23(32)29-27(36)31(26(19)35)21-9-5-4-8-20(21)28/h2-13H,14H2,1H3,(H,29,32,36) |
| InChIKey | PEAXRAADWHSNCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|