C28H20ClN3O7 — CID 3789467
1-(4-chlorophenyl)-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 3789467) has the molecular formula C28H20ClN3O7 and a molecular weight of 545.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-chlorophenyl)-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 3789467 |
| Molecular Formula | C28H20ClN3O7 |
| Molecular Weight | 545.94 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethoxyphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(OC)c(CN2C(=O)c3ccccc3C2=O)cc1C=C1C(=O)NC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C28H20ClN3O7/c1-38-22-13-23(39-2)16(14-31-25(34)19-5-3-4-6-20(19)26(31)35)11-15(22)12-21-24(33)30-28(37)32(27(21)36)18-9-7-17(29)8-10-18/h3-13H,14H2,1-2H3,(H,30,33,37) |
| InChIKey | NYDUZEGUNDLYEX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.94 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|