About 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane
2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane (PubChem CID 611215) has the molecular formula C12H18S2
and a molecular weight of 226.41 g/mol. Its IUPAC name is 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane.
Analyze 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane?
The IUPAC name of 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane (CID 611215) is 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane.
What is the SMILES notation for 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane?
The canonical SMILES for 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane is CC1(C)C=CC(=C2SCCCS2)CC1.
What is the InChIKey of 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane?
The InChIKey is KGAYAUBAPIJUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18S2/c1-12(2)6-4-10(5-7-12)11-13-8-3-9-14-11/h4,6H,3,5,7-9H2,1-2H3.
What are the key properties of 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane?
2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane has a molecular weight of 226.41 g/mol, XLogP of 4.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylcyclohex-2-en-1-ylidene)-1,3-dithiane is sourced from PubChem (CID 611215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).