C11H13N3O4S — CID 61122051
N-(1-cyanoethyl)-4,5-dimethyl-2-nitrobenzenesulfonamide (PubChem CID 61122051) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is N-(1-cyanoethyl)-4,5-dimethyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(1-cyanoethyl)-4,5-dimethyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 61122051 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(1-cyanoethyl)-4,5-dimethyl-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])c(S(=O)(=O)NC(C)C#N)cc1C |
| InChI | InChI=1S/C11H13N3O4S/c1-7-4-10(14(15)16)11(5-8(7)2)19(17,18)13-9(3)6-12/h4-5,9,13H,1-3H3 |
| InChIKey | GRTDMLBUHUANQQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|