C11H14N2O7S — CID 66166900
3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]-2-hydroxypropanoic acid (PubChem CID 66166900) has the molecular formula C11H14N2O7S and a molecular weight of 318.31 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]-2-hydroxypropanoic acid.
| Compound Name | 3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66166900 |
| Molecular Formula | C11H14N2O7S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-[(4,5-dimethyl-2-nitrophenyl)sulfonylamino]-2-hydroxypropanoic acid |
| SMILES | Cc1cc([N+](=O)[O-])c(S(=O)(=O)NCC(O)C(=O)O)cc1C |
| InChI | InChI=1S/C11H14N2O7S/c1-6-3-8(13(17)18)10(4-7(6)2)21(19,20)12-5-9(14)11(15)16/h3-4,9,12,14H,5H2,1-2H3,(H,15,16) |
| InChIKey | OXHXVBLVPDWVHE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|