C12H15N3O4S — CID 62653124
N-(2-cyanopropyl)-4,5-dimethyl-2-nitrobenzenesulfonamide (PubChem CID 62653124) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is N-(2-cyanopropyl)-4,5-dimethyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-cyanopropyl)-4,5-dimethyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 62653124 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-(2-cyanopropyl)-4,5-dimethyl-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])c(S(=O)(=O)NCC(C)C#N)cc1C |
| InChI | InChI=1S/C12H15N3O4S/c1-8(6-13)7-14-20(18,19)12-5-10(3)9(2)4-11(12)15(16)17/h4-5,8,14H,7H2,1-3H3 |
| InChIKey | FRLRLQOLDZQWTF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|