C7H16N2O2S2 — CID 61124286
2-ethyl-2-(methanesulfonamido)butanethioamide (PubChem CID 61124286) has the molecular formula C7H16N2O2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 2-ethyl-2-(methanesulfonamido)butanethioamide.
| Compound Name | 2-ethyl-2-(methanesulfonamido)butanethioamide |
|---|---|
| PubChem CID | 61124286 |
| Molecular Formula | C7H16N2O2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-ethyl-2-(methanesulfonamido)butanethioamide |
| SMILES | CCC(CC)(NS(C)(=O)=O)C(N)=S |
| InChI | InChI=1S/C7H16N2O2S2/c1-4-7(5-2,6(8)12)9-13(3,10)11/h9H,4-5H2,1-3H3,(H2,8,12) |
| InChIKey | UVKGBIIEUZYQKN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|