C22H19Cl2N3O2 — CID 6112463
2-(2,4-dichloroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6112463) has the molecular formula C22H19Cl2N3O2 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichloroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6112463 |
| Molecular Formula | C22H19Cl2N3O2 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 2-(2,4-dichloroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1Cl)N/N=C\c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N3O2/c23-18-10-11-20(19(24)12-18)25-14-22(28)27-26-13-17-8-4-5-9-21(17)29-15-16-6-2-1-3-7-16/h1-13,25H,14-15H2,(H,27,28)/b26-13- |
| InChIKey | AKXBRENUGVKPJE-ZMFRSBBQSA-N |
| XLogP | 5.13 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|