C15H12Cl2N2O3 — CID 8981080
2-[2-[(Z)-[(2,4-dichlorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 8981080) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is 2-[2-[(Z)-[(2,4-dichlorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[(2,4-dichlorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 8981080 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 2-[2-[(Z)-[(2,4-dichlorophenyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccccc1/C=N\Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H12Cl2N2O3/c16-11-5-6-13(12(17)7-11)19-18-8-10-3-1-2-4-14(10)22-9-15(20)21/h1-8,19H,9H2,(H,20,21)/b18-8- |
| InChIKey | FTUSNZVNHOJLBL-LSCVHKIXSA-N |
| XLogP | 3.90 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|