C12H25N3O2S — CID 61124963
N-(2-amino-1-cyclohexylethyl)pyrrolidine-1-sulfonamide (PubChem CID 61124963) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 61124963 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)pyrrolidine-1-sulfonamide |
| SMILES | NCC(NS(=O)(=O)N1CCCC1)C1CCCCC1 |
| InChI | InChI=1S/C12H25N3O2S/c13-10-12(11-6-2-1-3-7-11)14-18(16,17)15-8-4-5-9-15/h11-12,14H,1-10,13H2 |
| InChIKey | YNDIKPKNNCQUMX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |