C13H18N4O3S — CID 61126807
2-[(4-amino-2-cyanophenyl)sulfonyl-propylamino]-N-methylacetamide (PubChem CID 61126807) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[(4-amino-2-cyanophenyl)sulfonyl-propylamino]-N-methylacetamide.
| Compound Name | 2-[(4-amino-2-cyanophenyl)sulfonyl-propylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 61126807 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-[(4-amino-2-cyanophenyl)sulfonyl-propylamino]-N-methylacetamide |
| SMILES | CCCN(CC(=O)NC)S(=O)(=O)c1ccc(N)cc1C#N |
| InChI | InChI=1S/C13H18N4O3S/c1-3-6-17(9-13(18)16-2)21(19,20)12-5-4-11(15)7-10(12)8-14/h4-5,7H,3,6,9,15H2,1-2H3,(H,16,18) |
| InChIKey | WCSFNTDYNWCHES-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|