C14H26N6O — CID 61138265
2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide (PubChem CID 61138265) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide.
| Compound Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 61138265 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 2-(3-amino-1,2,4-triazol-1-yl)-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide |
| SMILES | CN(CCCNC(=O)Cn1cnc(N)n1)C1CCCCC1 |
| InChI | InChI=1S/C14H26N6O/c1-19(12-6-3-2-4-7-12)9-5-8-16-13(21)10-20-11-17-14(15)18-20/h11-12H,2-10H2,1H3,(H2,15,18)(H,16,21) |
| InChIKey | HIPQARSPAAKGMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|