C11H17N3O3S — CID 61142496
(2R)-2-amino-3-[2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 61142496) has the molecular formula C11H17N3O3S and a molecular weight of 271.34 g/mol. Its IUPAC name is (2R)-2-amino-3-[2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-[2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 61142496 |
| Molecular Formula | C11H17N3O3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (2R)-2-amino-3-[2-[(1-cyano-1-cyclopropylethyl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | CC(C#N)(NC(=O)CSC[C@H](N)C(=O)O)C1CC1 |
| InChI | InChI=1S/C11H17N3O3S/c1-11(6-12,7-2-3-7)14-9(15)5-18-4-8(13)10(16)17/h7-8H,2-5,13H2,1H3,(H,14,15)(H,16,17)/t8-,11?/m0/s1 |
| InChIKey | XHMOVYKSRFOXHB-YMNIQAILSA-N |
| XLogP | -0.06 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |