C14H22N2O — CID 61150490
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-N-(furan-2-ylmethyl)methanamine (PubChem CID 61150490) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-N-(furan-2-ylmethyl)methanamine.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-N-(furan-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 61150490 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-N-(furan-2-ylmethyl)methanamine |
| SMILES | c1coc(CNCC2CC3CCCCC3N2)c1 |
| InChI | InChI=1S/C14H22N2O/c1-2-6-14-11(4-1)8-12(16-14)9-15-10-13-5-3-7-17-13/h3,5,7,11-12,14-16H,1-2,4,6,8-10H2 |
| InChIKey | LSXDFNWGXUEWNH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |