C12H24N2O3S — CID 61161090
3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]-tert-butylamino]propanoic acid (PubChem CID 61161090) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]-tert-butylamino]propanoic acid.
| Compound Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]-tert-butylamino]propanoic acid |
|---|---|
| PubChem CID | 61161090 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylsulfanylbutanoyl]-tert-butylamino]propanoic acid |
| SMILES | CSCC[C@H](N)C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3S/c1-12(2,3)14(7-5-10(15)16)11(17)9(13)6-8-18-4/h9H,5-8,13H2,1-4H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | MPHBEZCDRUROKP-VIFPVBQESA-N |
| XLogP | 1.17 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |