C13H26N2O3 — CID 61161091
3-[[(2S)-2-amino-4-methylpentanoyl]-tert-butylamino]propanoic acid (PubChem CID 61161091) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylpentanoyl]-tert-butylamino]propanoic acid.
| Compound Name | 3-[[(2S)-2-amino-4-methylpentanoyl]-tert-butylamino]propanoic acid |
|---|---|
| PubChem CID | 61161091 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylpentanoyl]-tert-butylamino]propanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H26N2O3/c1-9(2)8-10(14)12(18)15(13(3,4)5)7-6-11(16)17/h9-10H,6-8,14H2,1-5H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | FXROHISBUDULTK-JTQLQIEISA-N |
| XLogP | 1.46 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |