C12H24N2O3 — CID 61161092
3-[[(2S)-2-amino-3-methylbutanoyl]-tert-butylamino]propanoic acid (PubChem CID 61161092) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-3-methylbutanoyl]-tert-butylamino]propanoic acid.
| Compound Name | 3-[[(2S)-2-amino-3-methylbutanoyl]-tert-butylamino]propanoic acid |
|---|---|
| PubChem CID | 61161092 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 3-[[(2S)-2-amino-3-methylbutanoyl]-tert-butylamino]propanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)N(CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H24N2O3/c1-8(2)10(13)11(17)14(12(3,4)5)7-6-9(15)16/h8,10H,6-7,13H2,1-5H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | PNSJIYDYNOFTRW-JTQLQIEISA-N |
| XLogP | 1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |