C16H19N3O2 — CID 61166764
2-[1-(4-methylphenoxy)propan-2-ylamino]pyridine-3-carboxamide (PubChem CID 61166764) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-[1-(4-methylphenoxy)propan-2-ylamino]pyridine-3-carboxamide.
| Compound Name | 2-[1-(4-methylphenoxy)propan-2-ylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 61166764 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-[1-(4-methylphenoxy)propan-2-ylamino]pyridine-3-carboxamide |
| SMILES | Cc1ccc(OCC(C)Nc2ncccc2C(N)=O)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-5-7-13(8-6-11)21-10-12(2)19-16-14(15(17)20)4-3-9-18-16/h3-9,12H,10H2,1-2H3,(H2,17,20)(H,18,19) |
| InChIKey | XYDMYOQPRNLAGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |