C16H26N2O3 — CID 61172776
N-tert-butyl-2-[1-(3,4-dimethoxyphenyl)ethylamino]acetamide (PubChem CID 61172776) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is N-tert-butyl-2-[1-(3,4-dimethoxyphenyl)ethylamino]acetamide.
| Compound Name | N-tert-butyl-2-[1-(3,4-dimethoxyphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 61172776 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-tert-butyl-2-[1-(3,4-dimethoxyphenyl)ethylamino]acetamide |
| SMILES | COc1ccc(C(C)NCC(=O)NC(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-11(17-10-15(19)18-16(2,3)4)12-7-8-13(20-5)14(9-12)21-6/h7-9,11,17H,10H2,1-6H3,(H,18,19) |
| InChIKey | QMISSSFODBUQLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |