C17H29NO3 — CID 66179353
1-[1-(3,4-dimethoxyphenyl)ethylamino]-2,4-dimethylpentan-2-ol (PubChem CID 66179353) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[1-(3,4-dimethoxyphenyl)ethylamino]-2,4-dimethylpentan-2-ol.
| Compound Name | 1-[1-(3,4-dimethoxyphenyl)ethylamino]-2,4-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 66179353 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[1-(3,4-dimethoxyphenyl)ethylamino]-2,4-dimethylpentan-2-ol |
| SMILES | COc1ccc(C(C)NCC(C)(O)CC(C)C)cc1OC |
| InChI | InChI=1S/C17H29NO3/c1-12(2)10-17(4,19)11-18-13(3)14-7-8-15(20-5)16(9-14)21-6/h7-9,12-13,18-19H,10-11H2,1-6H3 |
| InChIKey | HDEIWTRLEBJNIL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |