C14H18BrFN2O3 — CID 61182804
4-[(4-bromo-2-fluorophenyl)carbamoyl-propan-2-ylamino]butanoic acid (PubChem CID 61182804) has the molecular formula C14H18BrFN2O3 and a molecular weight of 361.21 g/mol. Its IUPAC name is 4-[(4-bromo-2-fluorophenyl)carbamoyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(4-bromo-2-fluorophenyl)carbamoyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 61182804 |
| Molecular Formula | C14H18BrFN2O3 |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | 4-[(4-bromo-2-fluorophenyl)carbamoyl-propan-2-ylamino]butanoic acid |
| SMILES | CC(C)N(CCCC(=O)O)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H18BrFN2O3/c1-9(2)18(7-3-4-13(19)20)14(21)17-12-6-5-10(15)8-11(12)16/h5-6,8-9H,3-4,7H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | NETYHMSGYAPLGH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |