C16H24N2O3 — CID 61200589
4-[(2,3-dimethylphenyl)carbamoyl-propan-2-ylamino]butanoic acid (PubChem CID 61200589) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[(2,3-dimethylphenyl)carbamoyl-propan-2-ylamino]butanoic acid.
| Compound Name | 4-[(2,3-dimethylphenyl)carbamoyl-propan-2-ylamino]butanoic acid |
|---|---|
| PubChem CID | 61200589 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[(2,3-dimethylphenyl)carbamoyl-propan-2-ylamino]butanoic acid |
| SMILES | Cc1cccc(NC(=O)N(CCCC(=O)O)C(C)C)c1C |
| InChI | InChI=1S/C16H24N2O3/c1-11(2)18(10-6-9-15(19)20)16(21)17-14-8-5-7-12(3)13(14)4/h5,7-8,11H,6,9-10H2,1-4H3,(H,17,21)(H,19,20) |
| InChIKey | OCDLZQUTCJFUJF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |