C13H17NO5S — CID 82180446
2-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfonylacetic acid (PubChem CID 82180446) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 2-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfonylacetic acid.
| Compound Name | 2-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfonylacetic acid |
|---|---|
| PubChem CID | 82180446 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-[1-(2,3-dimethylanilino)-1-oxopropan-2-yl]sulfonylacetic acid |
| SMILES | Cc1cccc(NC(=O)C(C)S(=O)(=O)CC(=O)O)c1C |
| InChI | InChI=1S/C13H17NO5S/c1-8-5-4-6-11(9(8)2)14-13(17)10(3)20(18,19)7-12(15)16/h4-6,10H,7H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | HBPIFSSHLDXGNF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |