C11H12BrFN2O3 — CID 62639550
2-[(4-bromo-2-fluorophenyl)carbamoyl-methylamino]propanoic acid (PubChem CID 62639550) has the molecular formula C11H12BrFN2O3 and a molecular weight of 319.13 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)carbamoyl-methylamino]propanoic acid.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 62639550 |
| Molecular Formula | C11H12BrFN2O3 |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)carbamoyl-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C11H12BrFN2O3/c1-6(10(16)17)15(2)11(18)14-9-4-3-7(12)5-8(9)13/h3-6H,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | NGFOIWKVQFXWJF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |