About 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid
4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 61196284) has the molecular formula C14H21N3O3S
and a molecular weight of 311.41 g/mol. Its IUPAC name is 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid |
| PubChem CID | 61196284 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NC(=O)Nc2nc(C)cs2)(C(=O)O)CC1 |
| InChI | InChI=1S/C14H21N3O3S/c1-3-10-4-6-14(7-5-10,11(18)19)17-12(20)16-13-15-9(2)8-21-13/h8,10H,3-7H2,1-2H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | NWJYYYQKOWIEEM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid?
The IUPAC name of 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid (CID 61196284) is 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid is CCC1CCC(NC(=O)Nc2nc(C)cs2)(C(=O)O)CC1.
What is the InChIKey of 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid?
The InChIKey is NWJYYYQKOWIEEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S/c1-3-10-4-6-14(7-5-10,11(18)19)17-12(20)16-13-15-9(2)8-21-13/h8,10H,3-7H2,1-2H3,(H,18,19)(H2,15,16,17,20).
What are the key properties of 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid?
4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid has a molecular weight of 311.41 g/mol, XLogP of 3.00, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-[(4-methyl-1,3-thiazol-2-yl)carbamoylamino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 61196284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).