About N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine
N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 61330024) has the molecular formula C14H24N2S
and a molecular weight of 252.43 g/mol. Its IUPAC name is N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| PubChem CID | 61330024 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | CCNC1(c2nc(C)cs2)CCC(CC)CC1 |
| InChI | InChI=1S/C14H24N2S/c1-4-12-6-8-14(9-7-12,15-5-2)13-16-11(3)10-17-13/h10,12,15H,4-9H2,1-3H3 |
| InChIKey | FQXUAQFLLUARHO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The IUPAC name of N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine (CID 61330024) is N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine.
What is the SMILES notation for N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The canonical SMILES for N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine is CCNC1(c2nc(C)cs2)CCC(CC)CC1.
What is the InChIKey of N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
The InChIKey is FQXUAQFLLUARHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2S/c1-4-12-6-8-14(9-7-12,15-5-2)13-16-11(3)10-17-13/h10,12,15H,4-9H2,1-3H3.
What are the key properties of N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine?
N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine has a molecular weight of 252.43 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-diethyl-1-(4-methyl-1,3-thiazol-2-yl)cyclohexan-1-amine is sourced from PubChem (CID 61330024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).