About N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine
N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine (PubChem CID 61331971) has the molecular formula C15H18N2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine.
Molecular Properties
| Compound Name | N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine |
| PubChem CID | 61331971 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine |
| SMILES | CCNC1(c2nc(C)cs2)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H18N2S/c1-3-16-15(14-17-11(2)10-18-14)8-12-6-4-5-7-13(12)9-15/h4-7,10,16H,3,8-9H2,1-2H3 |
| InChIKey | HTLVGRJAINRLFJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine?
The IUPAC name of N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine (CID 61331971) is N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine.
What is the SMILES notation for N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine?
The canonical SMILES for N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine is CCNC1(c2nc(C)cs2)Cc2ccccc2C1.
What is the InChIKey of N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine?
The InChIKey is HTLVGRJAINRLFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2S/c1-3-16-15(14-17-11(2)10-18-14)8-12-6-4-5-7-13(12)9-15/h4-7,10,16H,3,8-9H2,1-2H3.
What are the key properties of N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine?
N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine has a molecular weight of 258.39 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-(4-methyl-1,3-thiazol-2-yl)-1,3-dihydroinden-2-amine is sourced from PubChem (CID 61331971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).