About N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine
N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine (PubChem CID 61223759) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine.
Analyze N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine?
The IUPAC name of N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine (CID 61223759) is N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine.
What is the SMILES notation for N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine?
The canonical SMILES for N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine is CC1(C)CC1NCC1CCCCC1.
What is the InChIKey of N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine?
The InChIKey is SNYJPKQUXLGXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-12(2)8-11(12)13-9-10-6-4-3-5-7-10/h10-11,13H,3-9H2,1-2H3.
What are the key properties of N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine?
N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine has a molecular weight of 181.32 g/mol, XLogP of 2.95, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-2,2-dimethylcyclopropan-1-amine is sourced from PubChem (CID 61223759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).