C25H44N2O2 — CID 74443529
3-[3-(cyclohexylmethylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide (PubChem CID 74443529) has the molecular formula C25H44N2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-[3-(cyclohexylmethylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide.
| Compound Name | 3-[3-(cyclohexylmethylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 74443529 |
| Molecular Formula | C25H44N2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | 3-[3-(cyclohexylmethylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-cyclopropylpropanamide |
| SMILES | CC1(O)CCC2(CCC(=O)NC3CC3)C(NCC3CCCCC3)CC(C)(C)C2C1 |
| InChI | InChI=1S/C25H44N2O2/c1-23(2)16-21(26-17-18-7-5-4-6-8-18)25(12-11-22(28)27-19-9-10-19)14-13-24(3,29)15-20(23)25/h18-21,26,29H,4-17H2,1-3H3,(H,27,28) |
| InChIKey | HGRRFGYXQVDQTB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |