C22H40N2O3 — CID 28961191
3-[(3S,3aR,6S,7aS)-3-(cyclobutylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 28961191) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 3-[(3S,3aR,6S,7aS)-3-(cyclobutylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[(3S,3aR,6S,7aS)-3-(cyclobutylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 28961191 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 3-[(3S,3aR,6S,7aS)-3-(cyclobutylamino)-6-hydroxy-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CC[C@]12CC[C@](C)(O)C[C@H]1C(C)(C)C[C@@H]2NC1CCC1 |
| InChI | InChI=1S/C22H40N2O3/c1-20(2)15-18(24-16-6-5-7-16)22(9-8-19(25)23-12-13-27-4)11-10-21(3,26)14-17(20)22/h16-18,24,26H,5-15H2,1-4H3,(H,23,25)/t17-,18-,21-,22-/m0/s1 |
| InChIKey | CHQYDUYNLDKEBY-GPHNJDIKSA-N |
| XLogP | 3.01 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|