C24H44N2O4 — CID 25339674
N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3,3-dimethylbutanamide (PubChem CID 25339674) has the molecular formula C24H44N2O4 and a molecular weight of 424.63 g/mol. Its IUPAC name is N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 25339674 |
| Molecular Formula | C24H44N2O4 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.33 |
| IUPAC Name | N-[(1S,3aS,5S,7aR)-5-hydroxy-7a-[3-(2-methoxyethylamino)-3-oxopropyl]-3,3,5-trimethyl-1,2,3a,4,6,7-hexahydroinden-1-yl]-3,3-dimethylbutanamide |
| SMILES | COCCNC(=O)CC[C@]12CC[C@](C)(O)C[C@H]1C(C)(C)C[C@@H]2NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C24H44N2O4/c1-21(2,3)16-20(28)26-18-15-22(4,5)17-14-23(6,29)10-11-24(17,18)9-8-19(27)25-12-13-30-7/h17-18,29H,8-16H2,1-7H3,(H,25,27)(H,26,28)/t17-,18-,23-,24-/m0/s1 |
| InChIKey | AHZBBBSMZGEONV-MQQADFIWSA-N |
| XLogP | 3.42 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|