C21H38N2O5 — CID 74443511
3-[6-hydroxy-3-[(2-methoxyacetyl)amino]-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide (PubChem CID 74443511) has the molecular formula C21H38N2O5 and a molecular weight of 398.54 g/mol. Its IUPAC name is 3-[6-hydroxy-3-[(2-methoxyacetyl)amino]-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[6-hydroxy-3-[(2-methoxyacetyl)amino]-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 74443511 |
| Molecular Formula | C21H38N2O5 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 3-[6-hydroxy-3-[(2-methoxyacetyl)amino]-1,1,6-trimethyl-2,3,4,5,7,7a-hexahydroinden-3a-yl]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)CCC12CCC(C)(O)CC1C(C)(C)CC2NC(=O)COC |
| InChI | InChI=1S/C21H38N2O5/c1-19(2)13-16(23-18(25)14-28-5)21(7-6-17(24)22-10-11-27-4)9-8-20(3,26)12-15(19)21/h15-16,26H,6-14H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | UBAVYPSGGLKYBL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|