C16H21NO3S — CID 61224685
4-[5-methyl-2-(3-methylpyrrolidin-1-yl)sulfonylphenyl]but-3-yn-1-ol (PubChem CID 61224685) has the molecular formula C16H21NO3S and a molecular weight of 307.42 g/mol. Its IUPAC name is 4-[5-methyl-2-(3-methylpyrrolidin-1-yl)sulfonylphenyl]but-3-yn-1-ol.
| Compound Name | 4-[5-methyl-2-(3-methylpyrrolidin-1-yl)sulfonylphenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 61224685 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[5-methyl-2-(3-methylpyrrolidin-1-yl)sulfonylphenyl]but-3-yn-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C)C2)c(C#CCCO)c1 |
| InChI | InChI=1S/C16H21NO3S/c1-13-6-7-16(15(11-13)5-3-4-10-18)21(19,20)17-9-8-14(2)12-17/h6-7,11,14,18H,4,8-10,12H2,1-2H3 |
| InChIKey | CCGCSRAWIZNWSJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|