C11H22N2O6S — CID 61235459
N,N-bis(2-hydroxyethyl)-3-morpholin-4-ylsulfonylpropanamide (PubChem CID 61235459) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3-morpholin-4-ylsulfonylpropanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-3-morpholin-4-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 61235459 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3-morpholin-4-ylsulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)N1CCOCC1)N(CCO)CCO |
| InChI | InChI=1S/C11H22N2O6S/c14-6-2-12(3-7-15)11(16)1-10-20(17,18)13-4-8-19-9-5-13/h14-15H,1-10H2 |
| InChIKey | YASDJMNTPFAHFL-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |