C11H12N4O4 — CID 61243320
2-(2H-benzotriazole-5-carbonylamino)-4-hydroxybutanoic acid (PubChem CID 61243320) has the molecular formula C11H12N4O4 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-(2H-benzotriazole-5-carbonylamino)-4-hydroxybutanoic acid.
| Compound Name | 2-(2H-benzotriazole-5-carbonylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61243320 |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(2H-benzotriazole-5-carbonylamino)-4-hydroxybutanoic acid |
| SMILES | O=C(NC(CCO)C(=O)O)c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C11H12N4O4/c16-4-3-8(11(18)19)12-10(17)6-1-2-7-9(5-6)14-15-13-7/h1-2,5,8,16H,3-4H2,(H,12,17)(H,18,19)(H,13,14,15) |
| InChIKey | UDNVLHHPSRNLNA-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |